C10H12O2 — CID 59142288
2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid (PubChem CID 59142288) has the molecular formula C10H12O2 and a molecular weight of 175.27 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid.
| Compound Name | 2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid |
|---|---|
| PubChem CID | 59142288 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.15 |
| IUPAC Name | 2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O)c([2H])c1[2H] |
| InChI | InChI=1S/C10H12O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12)/i1D,2D,3D,4D2,5D,6D,7D2,8D2 |
| InChIKey | OBKXEAXTFZPCHS-VRWITDQQSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |