C9H8O2 — CID 102009729
(E)-3-(2,3,4,5,6-pentadeuteriophenyl)(2,3-13C2)prop-2-enoic acid (PubChem CID 102009729) has the molecular formula C9H8O2 and a molecular weight of 155.18 g/mol. Its IUPAC name is (E)-3-(2,3,4,5,6-pentadeuteriophenyl)(2,3-13C2)prop-2-enoic acid.
| Compound Name | (E)-3-(2,3,4,5,6-pentadeuteriophenyl)(2,3-13C2)prop-2-enoic acid |
|---|---|
| PubChem CID | 102009729 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (E)-3-(2,3,4,5,6-pentadeuteriophenyl)(2,3-13C2)prop-2-enoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(/[13CH]=[13CH]/C(=O)O)c([2H])c1[2H] |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+/i1D,2D,3D,4D,5D,6+1,7+1 |
| InChIKey | WBYWAXJHAXSJNI-JEVSBISLSA-N |
| XLogP | 1.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|