C15H12O2 — CID 71749251
(E)-1-(2-hydroxyphenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one (PubChem CID 71749251) has the molecular formula C15H12O2 and a molecular weight of 229.29 g/mol. Its IUPAC name is (E)-1-(2-hydroxyphenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-hydroxyphenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71749251 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | (E)-1-(2-hydroxyphenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one |
| SMILES | [2H]c1c([2H])c([2H])c(/C=C/C(=O)c2ccccc2O)c([2H])c1[2H] |
| InChI | InChI=1S/C15H12O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-11,16H/b11-10+/i1D,2D,3D,6D,7D |
| InChIKey | AETKQQBRKSELEL-CDTMZHDGSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|