C15H11ClO3 — CID 174535088
1-(4-chloro-2,5-dihydroxyphenyl)-3-phenylprop-2-en-1-one (PubChem CID 174535088) has the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dihydroxyphenyl)-3-phenylprop-2-en-1-one.
| Compound Name | 1-(4-chloro-2,5-dihydroxyphenyl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 174535088 |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-(4-chloro-2,5-dihydroxyphenyl)-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)c1cc(O)c(Cl)cc1O |
| InChI | InChI=1S/C15H11ClO3/c16-12-9-14(18)11(8-15(12)19)13(17)7-6-10-4-2-1-3-5-10/h1-9,18-19H |
| InChIKey | CMXBLVZJSGLQIK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|