C15H11FO3 — CID 178046170
(E)-1-(5-fluoro-2,4-dihydroxyphenyl)-3-phenylprop-2-en-1-one (PubChem CID 178046170) has the molecular formula C15H11FO3 and a molecular weight of 258.25 g/mol. Its IUPAC name is (E)-1-(5-fluoro-2,4-dihydroxyphenyl)-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-(5-fluoro-2,4-dihydroxyphenyl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 178046170 |
| Molecular Formula | C15H11FO3 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (E)-1-(5-fluoro-2,4-dihydroxyphenyl)-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)c1cc(F)c(O)cc1O |
| InChI | InChI=1S/C15H11FO3/c16-12-8-11(14(18)9-15(12)19)13(17)7-6-10-4-2-1-3-5-10/h1-9,18-19H/b7-6+ |
| InChIKey | DZEORZNDXZCHOM-VOTSOKGWSA-N |
| XLogP | 3.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|