C15H10Cl2O2 — CID 168806063
1-(2,4-dichloro-6-hydroxyphenyl)-3-phenylprop-2-en-1-one (PubChem CID 168806063) has the molecular formula C15H10Cl2O2 and a molecular weight of 293.15 g/mol. Its IUPAC name is 1-(2,4-dichloro-6-hydroxyphenyl)-3-phenylprop-2-en-1-one.
| Compound Name | 1-(2,4-dichloro-6-hydroxyphenyl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 168806063 |
| Molecular Formula | C15H10Cl2O2 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-(2,4-dichloro-6-hydroxyphenyl)-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)c1c(O)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl2O2/c16-11-8-12(17)15(14(19)9-11)13(18)7-6-10-4-2-1-3-5-10/h1-9,19H |
| InChIKey | BJEZYANNCIGPNK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|