C6H11ClO — CID 58172383
6-chloro-3,3,4,4,5,5,6,6-octadeuteriohexan-2-one (PubChem CID 58172383) has the molecular formula C6H11ClO and a molecular weight of 142.65 g/mol. Its IUPAC name is 6-chloro-3,3,4,4,5,5,6,6-octadeuteriohexan-2-one.
| Compound Name | 6-chloro-3,3,4,4,5,5,6,6-octadeuteriohexan-2-one |
|---|---|
| PubChem CID | 58172383 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 142.65 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 6-chloro-3,3,4,4,5,5,6,6-octadeuteriohexan-2-one |
| SMILES | [2H]C([2H])(Cl)C([2H])([2H])C([2H])([2H])C([2H])([2H])C(C)=O |
| InChI | InChI=1S/C6H11ClO/c1-6(8)4-2-3-5-7/h2-5H2,1H3/i2D2,3D2,4D2,5D2 |
| InChIKey | CMDIDTNMHQUVPE-UDCOFZOWSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|