C7H14O — CID 158019500
3,3,4,4-tetradeuterio-5-methylhexan-2-one (PubChem CID 158019500) has the molecular formula C7H14O and a molecular weight of 118.21 g/mol. Its IUPAC name is 3,3,4,4-tetradeuterio-5-methylhexan-2-one.
| Compound Name | 3,3,4,4-tetradeuterio-5-methylhexan-2-one |
|---|---|
| PubChem CID | 158019500 |
| Molecular Formula | C7H14O |
| Molecular Weight | 118.21 g/mol |
| Exact Mass | 118.13 |
| IUPAC Name | 3,3,4,4-tetradeuterio-5-methylhexan-2-one |
| SMILES | [2H]C([2H])(C(C)=O)C([2H])([2H])C(C)C |
| InChI | InChI=1S/C7H14O/c1-6(2)4-5-7(3)8/h6H,4-5H2,1-3H3/i4D2,5D2 |
| InChIKey | FFWSICBKRCICMR-CQOLUAMGSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |