C5H10Cl2N2O — CID 169436775
1,3-bis(2-chloro-1,1,2,2-tetradeuterioethyl)urea (PubChem CID 169436775) has the molecular formula C5H10Cl2N2O and a molecular weight of 193.10 g/mol. Its IUPAC name is 1,3-bis(2-chloro-1,1,2,2-tetradeuterioethyl)urea.
| Compound Name | 1,3-bis(2-chloro-1,1,2,2-tetradeuterioethyl)urea |
|---|---|
| PubChem CID | 169436775 |
| Molecular Formula | C5H10Cl2N2O |
| Molecular Weight | 193.10 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1,3-bis(2-chloro-1,1,2,2-tetradeuterioethyl)urea |
| SMILES | [2H]C([2H])(Cl)C([2H])([2H])NC(=O)NC([2H])([2H])C([2H])([2H])Cl |
| InChI | InChI=1S/C5H10Cl2N2O/c6-1-3-8-5(10)9-4-2-7/h1-4H2,(H2,8,9,10)/i1D2,2D2,3D2,4D2 |
| InChIKey | VBWBRZHAGLZNST-SVYQBANQSA-N |
| XLogP | 0.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.10 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|