C5H9Cl2N3O2 — CID 162642673
1,3-bis(2-chloro-1,1,2,2-tetradeuterioethyl)-1-nitrosourea (PubChem CID 162642673) has the molecular formula C5H9Cl2N3O2 and a molecular weight of 222.10 g/mol. Its IUPAC name is 1,3-bis(2-chloro-1,1,2,2-tetradeuterioethyl)-1-nitrosourea.
| Compound Name | 1,3-bis(2-chloro-1,1,2,2-tetradeuterioethyl)-1-nitrosourea |
|---|---|
| PubChem CID | 162642673 |
| Molecular Formula | C5H9Cl2N3O2 |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1,3-bis(2-chloro-1,1,2,2-tetradeuterioethyl)-1-nitrosourea |
| SMILES | [2H]C([2H])(Cl)C([2H])([2H])NC(=O)N(N=O)C([2H])([2H])C([2H])([2H])Cl |
| InChI | InChI=1S/C5H9Cl2N3O2/c6-1-3-8-5(11)10(9-12)4-2-7/h1-4H2,(H,8,11)/i1D2,2D2,3D2,4D2 |
| InChIKey | DLGOEMSEDOSKAD-SVYQBANQSA-N |
| XLogP | 1.16 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|