C5H7Cl4N3O2 — CID 87170843
1,3-bis(2,2-dichloroethyl)-1-nitrosourea (PubChem CID 87170843) has the molecular formula C5H7Cl4N3O2 and a molecular weight of 282.94 g/mol. Its IUPAC name is 1,3-bis(2,2-dichloroethyl)-1-nitrosourea.
| Compound Name | 1,3-bis(2,2-dichloroethyl)-1-nitrosourea |
|---|---|
| PubChem CID | 87170843 |
| Molecular Formula | C5H7Cl4N3O2 |
| Molecular Weight | 282.94 g/mol |
| Exact Mass | 280.93 |
| IUPAC Name | 1,3-bis(2,2-dichloroethyl)-1-nitrosourea |
| SMILES | O=NN(CC(Cl)Cl)C(=O)NCC(Cl)Cl |
| InChI | InChI=1S/C5H7Cl4N3O2/c6-3(7)1-10-5(13)12(11-14)2-4(8)9/h3-4H,1-2H2,(H,10,13) |
| InChIKey | DODOZGZINUEMEB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.94 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|