C5H9N3O — CID 11789256
5-azido-1,1,1,3,3,4,4-heptadeuteriopentan-2-one (PubChem CID 11789256) has the molecular formula C5H9N3O and a molecular weight of 134.19 g/mol. Its IUPAC name is 5-azido-1,1,1,3,3,4,4-heptadeuteriopentan-2-one.
| Compound Name | 5-azido-1,1,1,3,3,4,4-heptadeuteriopentan-2-one |
|---|---|
| PubChem CID | 11789256 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 134.19 g/mol |
| Exact Mass | 134.12 |
| IUPAC Name | 5-azido-1,1,1,3,3,4,4-heptadeuteriopentan-2-one |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])CN=[N+]=[N-] |
| InChI | InChI=1S/C5H9N3O/c1-5(9)3-2-4-7-8-6/h2-4H2,1H3/i1D3,2D2,3D2 |
| InChIKey | DKVGVVHAWZMYAR-NCKGIQLSSA-N |
| XLogP | 1.67 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|