C4H9ClMg — CID 58532645
magnesium;1,1,1,2,2,3,3-heptadeuteriobutane;chloride (PubChem CID 58532645) has the molecular formula C4H9ClMg and a molecular weight of 123.92 g/mol. Its IUPAC name is magnesium;1,1,1,2,2,3,3-heptadeuteriobutane;chloride.
| Compound Name | magnesium;1,1,1,2,2,3,3-heptadeuteriobutane;chloride |
|---|---|
| PubChem CID | 58532645 |
| Molecular Formula | C4H9ClMg |
| Molecular Weight | 123.92 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | magnesium;1,1,1,2,2,3,3-heptadeuteriobutane;chloride |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])[CH2-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C4H9.ClH.Mg/c1-3-4-2;;/h1,3-4H2,2H3;1H;/q-1;;+2/p-1/i2D3,3D2,4D2;; |
| InChIKey | QUXHCILOWRXCEO-VWJLZFRISA-M |
| XLogP | -1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.92 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|