C16H34Cl2Sn — CID 169439079
dichloro-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)stannane (PubChem CID 169439079) has the molecular formula C16H34Cl2Sn and a molecular weight of 450.27 g/mol. Its IUPAC name is dichloro-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)stannane.
| Compound Name | dichloro-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)stannane |
|---|---|
| PubChem CID | 169439079 |
| Molecular Formula | C16H34Cl2Sn |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | dichloro-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)stannane |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[Sn](Cl)(Cl)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/2C8H17.2ClH.Sn/c2*1-3-5-7-8-6-4-2;;;/h2*1,3-8H2,2H3;2*1H;/q;;;;+2/p-2/i2*1D2,2D3,3D2,4D2,5D2,6D2,7D2,8D2;;; |
| InChIKey | SBOSGIJGEHWBKV-SBKBNNTFSA-L |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |