C8H18 — CID 524592
1,1,1,2,2,3,3,4,4,5,5,6,7,7,7-pentadecadeuterio-6-methylheptane (PubChem CID 524592) has the molecular formula C8H18 and a molecular weight of 129.32 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,7,7,7-pentadecadeuterio-6-methylheptane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,7,7,7-pentadecadeuterio-6-methylheptane |
|---|---|
| PubChem CID | 524592 |
| Molecular Formula | C8H18 |
| Molecular Weight | 129.32 g/mol |
| Exact Mass | 129.24 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,7,7,7-pentadecadeuterio-6-methylheptane |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H18/c1-4-5-6-7-8(2)3/h8H,4-7H2,1-3H3/i1D3,2D3,4D2,5D2,6D2,7D2,8D |
| InChIKey | JVSWJIKNEAIKJW-MPQGGVBNSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |