C11H18O4 — CID 10585415
(3E)-2-deuterio-3-(1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexylidene)-2-methylbutanedioic acid (PubChem CID 10585415) has the molecular formula C11H18O4 and a molecular weight of 227.34 g/mol. Its IUPAC name is (3E)-2-deuterio-3-(1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexylidene)-2-methylbutanedioic acid.
| Compound Name | (3E)-2-deuterio-3-(1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexylidene)-2-methylbutanedioic acid |
|---|---|
| PubChem CID | 10585415 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | (3E)-2-deuterio-3-(1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexylidene)-2-methylbutanedioic acid |
| SMILES | [2H]/C(=C(\C(=O)O)C([2H])(C)C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C11H18O4/c1-3-4-5-6-7-9(11(14)15)8(2)10(12)13/h7-8H,3-6H2,1-2H3,(H,12,13)(H,14,15)/b9-7+/i1D3,3D2,4D2,5D2,6D2,7D,8D |
| InChIKey | YTUQECDNJQCQAE-UJLZYSFRSA-N |
| XLogP | 2.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|