C3H7Br — CID 23264209
1-bromo-1,1,2,3,3,3-hexadeuteriopropane (PubChem CID 23264209) has the molecular formula C3H7Br and a molecular weight of 129.03 g/mol. Its IUPAC name is 1-bromo-1,1,2,3,3,3-hexadeuteriopropane.
| Compound Name | 1-bromo-1,1,2,3,3,3-hexadeuteriopropane |
|---|---|
| PubChem CID | 23264209 |
| Molecular Formula | C3H7Br |
| Molecular Weight | 129.03 g/mol |
| Exact Mass | 128.01 |
| IUPAC Name | 1-bromo-1,1,2,3,3,3-hexadeuteriopropane |
| SMILES | [2H]C(C([2H])([2H])[2H])C([2H])([2H])Br |
| InChI | InChI=1S/C3H7Br/c1-2-3-4/h2-3H2,1H3/i1D3,2D,3D2 |
| InChIKey | CYNYIHKIEHGYOZ-CNQUWIHNSA-N |
| XLogP | 1.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.03 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|