C8H15BrO2 — CID 160882921
tert-butyl 4-bromo-3,3,4,4-tetradeuteriobutanoate (PubChem CID 160882921) has the molecular formula C8H15BrO2 and a molecular weight of 227.13 g/mol. Its IUPAC name is tert-butyl 4-bromo-3,3,4,4-tetradeuteriobutanoate.
| Compound Name | tert-butyl 4-bromo-3,3,4,4-tetradeuteriobutanoate |
|---|---|
| PubChem CID | 160882921 |
| Molecular Formula | C8H15BrO2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | tert-butyl 4-bromo-3,3,4,4-tetradeuteriobutanoate |
| SMILES | [2H]C([2H])(Br)C([2H])([2H])CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H15BrO2/c1-8(2,3)11-7(10)5-4-6-9/h4-6H2,1-3H3/i4D2,6D2 |
| InChIKey | HJEZRYIJNHAIGY-WVTKESLNSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|