About tert-butyl 7-bromo-6,6-difluoroheptanoate
tert-butyl 7-bromo-6,6-difluoroheptanoate (PubChem CID 10780619) has the molecular formula C11H19BrF2O2
and a molecular weight of 301.17 g/mol. Its IUPAC name is tert-butyl 7-bromo-6,6-difluoroheptanoate.
Molecular Properties
| Compound Name | tert-butyl 7-bromo-6,6-difluoroheptanoate |
| PubChem CID | 10780619 |
| Molecular Formula | C11H19BrF2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | tert-butyl 7-bromo-6,6-difluoroheptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCC(F)(F)CBr |
| InChI | InChI=1S/C11H19BrF2O2/c1-10(2,3)16-9(15)6-4-5-7-11(13,14)8-12/h4-8H2,1-3H3 |
| InChIKey | AKNLKCHRPSRASY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 7-bromo-6,6-difluoroheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-bromo-6,6-difluoroheptanoate?
The IUPAC name of tert-butyl 7-bromo-6,6-difluoroheptanoate (CID 10780619) is tert-butyl 7-bromo-6,6-difluoroheptanoate.
What is the SMILES notation for tert-butyl 7-bromo-6,6-difluoroheptanoate?
The canonical SMILES for tert-butyl 7-bromo-6,6-difluoroheptanoate is CC(C)(C)OC(=O)CCCCC(F)(F)CBr.
What is the InChIKey of tert-butyl 7-bromo-6,6-difluoroheptanoate?
The InChIKey is AKNLKCHRPSRASY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrF2O2/c1-10(2,3)16-9(15)6-4-5-7-11(13,14)8-12/h4-8H2,1-3H3.
What are the key properties of tert-butyl 7-bromo-6,6-difluoroheptanoate?
tert-butyl 7-bromo-6,6-difluoroheptanoate has a molecular weight of 301.17 g/mol, XLogP of 3.92, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-bromo-6,6-difluoroheptanoate is sourced from PubChem (CID 10780619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).