C24H42BrNO7 — CID 24728093
ditert-butyl 4-[(2-bromoacetyl)amino]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate (PubChem CID 24728093) has the molecular formula C24H42BrNO7 and a molecular weight of 536.50 g/mol. Its IUPAC name is ditert-butyl 4-[(2-bromoacetyl)amino]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate.
| Compound Name | ditert-butyl 4-[(2-bromoacetyl)amino]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate |
|---|---|
| PubChem CID | 24728093 |
| Molecular Formula | C24H42BrNO7 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | ditert-butyl 4-[(2-bromoacetyl)amino]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)NC(=O)CBr |
| InChI | InChI=1S/C24H42BrNO7/c1-21(2,3)31-18(28)10-13-24(26-17(27)16-25,14-11-19(29)32-22(4,5)6)15-12-20(30)33-23(7,8)9/h10-16H2,1-9H3,(H,26,27) |
| InChIKey | UEXJSJCJDOCVBI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|