C31H51N3O9 — CID 87152768
ditert-butyl 4-[[7-amino-7-oxo-4-(3-oxopropyl)-4-(prop-2-enoylamino)heptanoyl]amino]-4-(3-oxopropyl)heptanedioate (PubChem CID 87152768) has the molecular formula C31H51N3O9 and a molecular weight of 609.76 g/mol. Its IUPAC name is ditert-butyl 4-[[7-amino-7-oxo-4-(3-oxopropyl)-4-(prop-2-enoylamino)heptanoyl]amino]-4-(3-oxopropyl)heptanedioate.
| Compound Name | ditert-butyl 4-[[7-amino-7-oxo-4-(3-oxopropyl)-4-(prop-2-enoylamino)heptanoyl]amino]-4-(3-oxopropyl)heptanedioate |
|---|---|
| PubChem CID | 87152768 |
| Molecular Formula | C31H51N3O9 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.36 |
| IUPAC Name | ditert-butyl 4-[[7-amino-7-oxo-4-(3-oxopropyl)-4-(prop-2-enoylamino)heptanoyl]amino]-4-(3-oxopropyl)heptanedioate |
| SMILES | C=CC(=O)NC(CCC=O)(CCC(N)=O)CCC(=O)NC(CCC=O)(CCC(=O)OC(C)(C)C)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H51N3O9/c1-8-24(38)33-30(15-9-21-35,17-11-23(32)37)18-12-25(39)34-31(16-10-22-36,19-13-26(40)42-28(2,3)4)20-14-27(41)43-29(5,6)7/h8,21-22H,1,9-20H2,2-7H3,(H2,32,37)(H,33,38)(H,34,39) |
| InChIKey | MTEKHQCBXSEBCZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 188.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|