C5H11Br — CID 87666732
1-bromo-1,1,2-trideuteriopentane (PubChem CID 87666732) has the molecular formula C5H11Br and a molecular weight of 154.07 g/mol. Its IUPAC name is 1-bromo-1,1,2-trideuteriopentane.
| Compound Name | 1-bromo-1,1,2-trideuteriopentane |
|---|---|
| PubChem CID | 87666732 |
| Molecular Formula | C5H11Br |
| Molecular Weight | 154.07 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 1-bromo-1,1,2-trideuteriopentane |
| SMILES | [2H]C(CCC)C([2H])([2H])Br |
| InChI | InChI=1S/C5H11Br/c1-2-3-4-5-6/h2-5H2,1H3/i4D,5D2 |
| InChIKey | YZWKKMVJZFACSU-GRRZFFPDSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.07 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|