C3H6Br2 — CID 54387418
1,3-dibromo-1,1,3,3-tetradeuteriopropane (PubChem CID 54387418) has the molecular formula C3H6Br2 and a molecular weight of 205.91 g/mol. Its IUPAC name is 1,3-dibromo-1,1,3,3-tetradeuteriopropane.
| Compound Name | 1,3-dibromo-1,1,3,3-tetradeuteriopropane |
|---|---|
| PubChem CID | 54387418 |
| Molecular Formula | C3H6Br2 |
| Molecular Weight | 205.91 g/mol |
| Exact Mass | 203.91 |
| IUPAC Name | 1,3-dibromo-1,1,3,3-tetradeuteriopropane |
| SMILES | [2H]C([2H])(Br)CC([2H])([2H])Br |
| InChI | InChI=1S/C3H6Br2/c4-2-1-3-5/h1-3H2/i2D2,3D2 |
| InChIKey | VEFLKXRACNJHOV-RRVWJQJTSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.91 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|