C7H13Br — CID 58282773
7-bromo-3,3,4,4-tetradeuteriohept-1-ene (PubChem CID 58282773) has the molecular formula C7H13Br and a molecular weight of 181.11 g/mol. Its IUPAC name is 7-bromo-3,3,4,4-tetradeuteriohept-1-ene.
| Compound Name | 7-bromo-3,3,4,4-tetradeuteriohept-1-ene |
|---|---|
| PubChem CID | 58282773 |
| Molecular Formula | C7H13Br |
| Molecular Weight | 181.11 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 7-bromo-3,3,4,4-tetradeuteriohept-1-ene |
| SMILES | [2H]C([2H])(C=C)C([2H])([2H])CCCBr |
| InChI | InChI=1S/C7H13Br/c1-2-3-4-5-6-7-8/h2H,1,3-7H2/i3D2,4D2 |
| InChIKey | GNYDYUQVALBGGZ-KHORGVISSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.11 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|