C7H15Br — CID 131701124
1-bromo-1,1,2,2,3,3,4-heptadeuterioheptane (PubChem CID 131701124) has the molecular formula C7H15Br and a molecular weight of 186.14 g/mol. Its IUPAC name is 1-bromo-1,1,2,2,3,3,4-heptadeuterioheptane.
| Compound Name | 1-bromo-1,1,2,2,3,3,4-heptadeuterioheptane |
|---|---|
| PubChem CID | 131701124 |
| Molecular Formula | C7H15Br |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 1-bromo-1,1,2,2,3,3,4-heptadeuterioheptane |
| SMILES | [2H]C(CCC)C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
| InChI | InChI=1S/C7H15Br/c1-2-3-4-5-6-7-8/h2-7H2,1H3/i4D,5D2,6D2,7D2 |
| InChIKey | LSXKDWGTSHCFPP-FKODDHCYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|