C3H9NO — CID 123598986
1-amino-1,1,2,3,3,3-hexadeuteriopropan-2-ol (PubChem CID 123598986) has the molecular formula C3H9NO and a molecular weight of 81.15 g/mol. Its IUPAC name is 1-amino-1,1,2,3,3,3-hexadeuteriopropan-2-ol.
| Compound Name | 1-amino-1,1,2,3,3,3-hexadeuteriopropan-2-ol |
|---|---|
| PubChem CID | 123598986 |
| Molecular Formula | C3H9NO |
| Molecular Weight | 81.15 g/mol |
| Exact Mass | 81.11 |
| IUPAC Name | 1-amino-1,1,2,3,3,3-hexadeuteriopropan-2-ol |
| SMILES | [2H]C([2H])([2H])C([2H])(O)C([2H])([2H])N |
| InChI | InChI=1S/C3H9NO/c1-3(5)2-4/h3,5H,2,4H2,1H3/i1D3,2D2,3D |
| InChIKey | HXKKHQJGJAFBHI-LIDOUZCJSA-N |
| XLogP | -0.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 81.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |