C4H11NO — CID 172990148
(2S)-2-amino-1,1,2,3,3,4,4,4-octadeuteriobutan-1-ol (PubChem CID 172990148) has the molecular formula C4H11NO and a molecular weight of 97.19 g/mol. Its IUPAC name is (2S)-2-amino-1,1,2,3,3,4,4,4-octadeuteriobutan-1-ol.
| Compound Name | (2S)-2-amino-1,1,2,3,3,4,4,4-octadeuteriobutan-1-ol |
|---|---|
| PubChem CID | 172990148 |
| Molecular Formula | C4H11NO |
| Molecular Weight | 97.19 g/mol |
| Exact Mass | 97.13 |
| IUPAC Name | (2S)-2-amino-1,1,2,3,3,4,4,4-octadeuteriobutan-1-ol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[C@]([2H])(N)C([2H])([2H])O |
| InChI | InChI=1S/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/t4-/m0/s1/i1D3,2D2,3D2,4D |
| InChIKey | JCBPETKZIGVZRE-MCXBZGAWSA-N |
| XLogP | -0.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |