C6H12O2 — CID 162343683
deuterio 2,2,3,4,4,5,5,5-octadeuterio-3-(dideuteriomethyl)pentanoate (PubChem CID 162343683) has the molecular formula C6H12O2 and a molecular weight of 127.23 g/mol. Its IUPAC name is deuterio 2,2,3,4,4,5,5,5-octadeuterio-3-(dideuteriomethyl)pentanoate.
| Compound Name | deuterio 2,2,3,4,4,5,5,5-octadeuterio-3-(dideuteriomethyl)pentanoate |
|---|---|
| PubChem CID | 162343683 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.15 |
| IUPAC Name | deuterio 2,2,3,4,4,5,5,5-octadeuterio-3-(dideuteriomethyl)pentanoate |
| SMILES | [2H]OC(=O)C([2H])([2H])C([2H])(C([2H])[2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H12O2/c1-3-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/i1D3,2D2,3D2,4D2,5D/hD |
| InChIKey | IGIDLTISMCAULB-VFUFDSLJSA-N |
| XLogP | 1.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |