About 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate
1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate (PubChem CID 155666215) has the molecular formula C5H8O4
and a molecular weight of 135.13 g/mol. Its IUPAC name is 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate.
Molecular Properties
| Compound Name | 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate |
| PubChem CID | 155666215 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.06 |
| IUPAC Name | 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate |
| SMILES | [2H]OC(=O)C([2H])([2H])C(=O)OCC |
| InChI | InChI=1S/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7)/i3D2/hD |
| InChIKey | HGINADPHJQTSKN-DZCFLQKHSA-N |
| XLogP | 0.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate?
The IUPAC name of 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate (CID 155666215) is 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate.
What is the SMILES notation for 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate?
The canonical SMILES for 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate is [2H]OC(=O)C([2H])([2H])C(=O)OCC.
What is the InChIKey of 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate?
The InChIKey is HGINADPHJQTSKN-DZCFLQKHSA-N. The full InChI is InChI=1S/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7)/i3D2/hD.
What are the key properties of 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate?
1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate has a molecular weight of 135.13 g/mol, XLogP of 0.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-deuterio 3-O-ethyl 2,2-dideuteriopropanedioate is sourced from PubChem (CID 155666215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).