C5H12N2O — CID 169433264
2-amino-N-(1,1,2,2,2-pentadeuterioethyl)propanamide (PubChem CID 169433264) has the molecular formula C5H12N2O and a molecular weight of 121.19 g/mol. Its IUPAC name is 2-amino-N-(1,1,2,2,2-pentadeuterioethyl)propanamide.
| Compound Name | 2-amino-N-(1,1,2,2,2-pentadeuterioethyl)propanamide |
|---|---|
| PubChem CID | 169433264 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 121.19 g/mol |
| Exact Mass | 121.13 |
| IUPAC Name | 2-amino-N-(1,1,2,2,2-pentadeuterioethyl)propanamide |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC(=O)C(C)N |
| InChI | InChI=1S/C5H12N2O/c1-3-7-5(8)4(2)6/h4H,3,6H2,1-2H3,(H,7,8)/i1D3,3D2 |
| InChIKey | SKPCTMWFLGENTL-WNWXXORZSA-N |
| XLogP | -0.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |