C6H14N2O4S — CID 175355008
3-(2-aminopropanoylamino)-3,3-dideuteriopropane-1-sulfonic acid (PubChem CID 175355008) has the molecular formula C6H14N2O4S and a molecular weight of 212.27 g/mol. Its IUPAC name is 3-(2-aminopropanoylamino)-3,3-dideuteriopropane-1-sulfonic acid.
| Compound Name | 3-(2-aminopropanoylamino)-3,3-dideuteriopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 175355008 |
| Molecular Formula | C6H14N2O4S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-(2-aminopropanoylamino)-3,3-dideuteriopropane-1-sulfonic acid |
| SMILES | [2H]C([2H])(CCS(=O)(=O)O)NC(=O)C(C)N |
| InChI | InChI=1S/C6H14N2O4S/c1-5(7)6(9)8-3-2-4-13(10,11)12/h5H,2-4,7H2,1H3,(H,8,9)(H,10,11,12)/i3D2 |
| InChIKey | HLQGJSWOBCMMQP-SMZGMGDZSA-N |
| XLogP | -1.27 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|