C3H8O2 — CID 71309005
1,1,2,3,3,3-hexadeuteriopropane-1,2-diol (PubChem CID 71309005) has the molecular formula C3H8O2 and a molecular weight of 82.13 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexadeuteriopropane-1,2-diol.
| Compound Name | 1,1,2,3,3,3-hexadeuteriopropane-1,2-diol |
|---|---|
| PubChem CID | 71309005 |
| Molecular Formula | C3H8O2 |
| Molecular Weight | 82.13 g/mol |
| Exact Mass | 82.09 |
| IUPAC Name | 1,1,2,3,3,3-hexadeuteriopropane-1,2-diol |
| SMILES | [2H]C([2H])([2H])C([2H])(O)C([2H])([2H])O |
| InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3/i1D3,2D2,3D |
| InChIKey | DNIAPMSPPWPWGF-LIDOUZCJSA-N |
| XLogP | -0.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 82.13 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |