C5H12O — CID 178022826
1,1,1,2,3-pentadeuteriopentan-2-ol (PubChem CID 178022826) has the molecular formula C5H12O and a molecular weight of 93.18 g/mol. Its IUPAC name is 1,1,1,2,3-pentadeuteriopentan-2-ol.
| Compound Name | 1,1,1,2,3-pentadeuteriopentan-2-ol |
|---|---|
| PubChem CID | 178022826 |
| Molecular Formula | C5H12O |
| Molecular Weight | 93.18 g/mol |
| Exact Mass | 93.12 |
| IUPAC Name | 1,1,1,2,3-pentadeuteriopentan-2-ol |
| SMILES | [2H]C(CC)C([2H])(O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C5H12O/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3/i2D3,4D,5D |
| InChIKey | JYVLIDXNZAXMDK-VMJINSEISA-N |
| XLogP | 1.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 93.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |