C12H24O — CID 175813049
3,6-dideuteriododec-9-en-4-ol (PubChem CID 175813049) has the molecular formula C12H24O and a molecular weight of 186.34 g/mol. Its IUPAC name is 3,6-dideuteriododec-9-en-4-ol.
| Compound Name | 3,6-dideuteriododec-9-en-4-ol |
|---|---|
| PubChem CID | 175813049 |
| Molecular Formula | C12H24O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 3,6-dideuteriododec-9-en-4-ol |
| SMILES | [2H]C(CCC=CCC)CC(O)C([2H])CC |
| InChI | InChI=1S/C12H24O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h5-6,12-13H,3-4,7-11H2,1-2H3/i9D,10D |
| InChIKey | HVYDLJKTLXKSLP-QDRJLNDYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|