C4H11N — CID 171382411
(2S)-1,1,1,3,3-pentadeuteriobutan-2-amine (PubChem CID 171382411) has the molecular formula C4H11N and a molecular weight of 78.17 g/mol. Its IUPAC name is (2S)-1,1,1,3,3-pentadeuteriobutan-2-amine.
| Compound Name | (2S)-1,1,1,3,3-pentadeuteriobutan-2-amine |
|---|---|
| PubChem CID | 171382411 |
| Molecular Formula | C4H11N |
| Molecular Weight | 78.17 g/mol |
| Exact Mass | 78.12 |
| IUPAC Name | (2S)-1,1,1,3,3-pentadeuteriobutan-2-amine |
| SMILES | [2H]C([2H])([2H])[C@H](N)C([2H])([2H])C |
| InChI | InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3/t4-/m0/s1/i2D3,3D2 |
| InChIKey | BHRZNVHARXXAHW-IJWGVKMNSA-N |
| XLogP | 0.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 78.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |