C6H15N — CID 100990746
(2R,3S)-3-deuterio-4-methylpentan-2-amine (PubChem CID 100990746) has the molecular formula C6H15N and a molecular weight of 102.20 g/mol. Its IUPAC name is (2R,3S)-3-deuterio-4-methylpentan-2-amine.
| Compound Name | (2R,3S)-3-deuterio-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 100990746 |
| Molecular Formula | C6H15N |
| Molecular Weight | 102.20 g/mol |
| Exact Mass | 102.13 |
| IUPAC Name | (2R,3S)-3-deuterio-4-methylpentan-2-amine |
| SMILES | [2H][C@@H](C(C)C)[C@@H](C)N |
| InChI | InChI=1S/C6H15N/c1-5(2)4-6(3)7/h5-6H,4,7H2,1-3H3/t6-/m1/s1/i4D/t4-,6+/m0 |
| InChIKey | UNBMPKNTYKDYCG-JHHSRGDNSA-N |
| XLogP | 1.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |