About methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride
methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride (PubChem CID 135890686) has the molecular formula C7H16ClNO2
and a molecular weight of 183.68 g/mol. Its IUPAC name is methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride |
| PubChem CID | 135890686 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride |
| SMILES | Cl.[2H][C@@H](C(C)C)[C@@]([2H])(N)C(=O)OC |
| InChI | InChI=1S/C7H15NO2.ClH/c1-5(2)4-6(8)7(9)10-3;/h5-6H,4,8H2,1-3H3;1H/t6-;/m1./s1/i4D,6D;/t4-,6+;/m0. |
| InChIKey | DODCBMODXGJOKD-XXNXWAEWSA-N |
| XLogP | 0.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride?
The IUPAC name of methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride (CID 135890686) is methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride.
What is the SMILES notation for methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride?
The canonical SMILES for methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride is Cl.[2H][C@@H](C(C)C)[C@@]([2H])(N)C(=O)OC.
What is the InChIKey of methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride?
The InChIKey is DODCBMODXGJOKD-XXNXWAEWSA-N. The full InChI is InChI=1S/C7H15NO2.ClH/c1-5(2)4-6(8)7(9)10-3;/h5-6H,4,8H2,1-3H3;1H/t6-;/m1./s1/i4D,6D;/t4-,6+;/m0..
What are the key properties of methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride?
methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride has a molecular weight of 183.68 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3S)-2-amino-2,3-dideuterio-4-methylpentanoate;hydrochloride is sourced from PubChem (CID 135890686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).