C4H9Cl — CID 102602370
2-chloro-1,1,1,2,3,3,4,4,4-nonadeuteriobutane (PubChem CID 102602370) has the molecular formula C4H9Cl and a molecular weight of 101.62 g/mol. Its IUPAC name is 2-chloro-1,1,1,2,3,3,4,4,4-nonadeuteriobutane.
| Compound Name | 2-chloro-1,1,1,2,3,3,4,4,4-nonadeuteriobutane |
|---|---|
| PubChem CID | 102602370 |
| Molecular Formula | C4H9Cl |
| Molecular Weight | 101.62 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 2-chloro-1,1,1,2,3,3,4,4,4-nonadeuteriobutane |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(Cl)C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H9Cl/c1-3-4(2)5/h4H,3H2,1-2H3/i1D3,2D3,3D2,4D |
| InChIKey | BSPCSKHALVHRSR-CBZKUFJVSA-N |
| XLogP | 2.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.62 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|