C8H18 — CID 158741711
1,1,1,2,4,4-hexadeuterio-2,3,3-trimethylpentane (PubChem CID 158741711) has the molecular formula C8H18 and a molecular weight of 120.27 g/mol. Its IUPAC name is 1,1,1,2,4,4-hexadeuterio-2,3,3-trimethylpentane.
| Compound Name | 1,1,1,2,4,4-hexadeuterio-2,3,3-trimethylpentane |
|---|---|
| PubChem CID | 158741711 |
| Molecular Formula | C8H18 |
| Molecular Weight | 120.27 g/mol |
| Exact Mass | 120.18 |
| IUPAC Name | 1,1,1,2,4,4-hexadeuterio-2,3,3-trimethylpentane |
| SMILES | [2H]C([2H])([2H])C([2H])(C)C(C)(C)C([2H])([2H])C |
| InChI | InChI=1S/C8H18/c1-6-8(4,5)7(2)3/h7H,6H2,1-5H3/i2D3,6D2,7D |
| InChIKey | OKVWYBALHQFVFP-PGLKUBNHSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |