C10H24N2O2 — CID 171700736
1,1,2-trideuterio-2-[[1,1,2,2-tetradeuterio-2-[(1,1,2-trideuterio-1-hydroxybutan-2-yl)amino]ethyl]amino]butan-1-ol (PubChem CID 171700736) has the molecular formula C10H24N2O2 and a molecular weight of 214.38 g/mol. Its IUPAC name is 1,1,2-trideuterio-2-[[1,1,2,2-tetradeuterio-2-[(1,1,2-trideuterio-1-hydroxybutan-2-yl)amino]ethyl]amino]butan-1-ol.
| Compound Name | 1,1,2-trideuterio-2-[[1,1,2,2-tetradeuterio-2-[(1,1,2-trideuterio-1-hydroxybutan-2-yl)amino]ethyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 171700736 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.25 |
| IUPAC Name | 1,1,2-trideuterio-2-[[1,1,2,2-tetradeuterio-2-[(1,1,2-trideuterio-1-hydroxybutan-2-yl)amino]ethyl]amino]butan-1-ol |
| SMILES | [2H]C([2H])(O)C([2H])(CC)NC([2H])([2H])C([2H])([2H])NC([2H])(CC)C([2H])([2H])O |
| InChI | InChI=1S/C10H24N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3/i5D2,6D2,7D2,8D2,9D,10D |
| InChIKey | AEUTYOVWOVBAKS-CPLHHLCZSA-N |
| XLogP | -0.29 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |