C7H20N4 — CID 90942747
3-(aminomethyl)hexane-1,2,6-triamine (PubChem CID 90942747) has the molecular formula C7H20N4 and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-(aminomethyl)hexane-1,2,6-triamine.
| Compound Name | 3-(aminomethyl)hexane-1,2,6-triamine |
|---|---|
| PubChem CID | 90942747 |
| Molecular Formula | C7H20N4 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.17 |
| IUPAC Name | 3-(aminomethyl)hexane-1,2,6-triamine |
| SMILES | NCCCC(CN)C(N)CN |
| InChI | InChI=1S/C7H20N4/c8-3-1-2-6(4-9)7(11)5-10/h6-7H,1-5,8-11H2 |
| InChIKey | DTOUSULEBUDJHY-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |