C5H22N6 — CID 87974080
2-(aminomethyl)butane-1,1,4-triamine;azane (PubChem CID 87974080) has the molecular formula C5H22N6 and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-(aminomethyl)butane-1,1,4-triamine;azane.
| Compound Name | 2-(aminomethyl)butane-1,1,4-triamine;azane |
|---|---|
| PubChem CID | 87974080 |
| Molecular Formula | C5H22N6 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.19 |
| IUPAC Name | 2-(aminomethyl)butane-1,1,4-triamine;azane |
| SMILES | N.N.NCCC(CN)C(N)N |
| InChI | InChI=1S/C5H16N4.2H3N/c6-2-1-4(3-7)5(8)9;;/h4-5H,1-3,6-9H2;2*1H3 |
| InChIKey | ICGSDYNDLZKXPD-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 174.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|