C5H13ClF2N2 — CID 22752191
5,5-difluoropentane-1,4-diamine;hydrochloride (PubChem CID 22752191) has the molecular formula C5H13ClF2N2 and a molecular weight of 174.62 g/mol. Its IUPAC name is 5,5-difluoropentane-1,4-diamine;hydrochloride.
| Compound Name | 5,5-difluoropentane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 22752191 |
| Molecular Formula | C5H13ClF2N2 |
| Molecular Weight | 174.62 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 5,5-difluoropentane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCCC(N)C(F)F |
| InChI | InChI=1S/C5H12F2N2.ClH/c6-5(7)4(9)2-1-3-8;/h4-5H,1-3,8-9H2;1H |
| InChIKey | QNRXHKFTCVOQIC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.62 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |