C4H11LiN2O3S — CID 175068866
lithium 1,4-diaminobutane-1-sulfonate (PubChem CID 175068866) has the molecular formula C4H11LiN2O3S and a molecular weight of 174.15 g/mol. Its IUPAC name is lithium 1,4-diaminobutane-1-sulfonate.
| Compound Name | lithium 1,4-diaminobutane-1-sulfonate |
|---|---|
| PubChem CID | 175068866 |
| Molecular Formula | C4H11LiN2O3S |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | lithium 1,4-diaminobutane-1-sulfonate |
| SMILES | NCCCC(N)S(=O)(=O)[O-].[Li+] |
| InChI | InChI=1S/C4H12N2O3S.Li/c5-3-1-2-4(6)10(7,8)9;/h4H,1-3,5-6H2,(H,7,8,9);/q;+1/p-1 |
| InChIKey | DROWGINJTJQMIV-UHFFFAOYSA-M |
| XLogP | -4.44 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|