C6H15ClN2 — CID 163782242
2-chloro-N-methylpentane-1,5-diamine (PubChem CID 163782242) has the molecular formula C6H15ClN2 and a molecular weight of 150.65 g/mol. Its IUPAC name is 2-chloro-N-methylpentane-1,5-diamine.
| Compound Name | 2-chloro-N-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 163782242 |
| Molecular Formula | C6H15ClN2 |
| Molecular Weight | 150.65 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2-chloro-N-methylpentane-1,5-diamine |
| SMILES | CNCC(Cl)CCCN |
| InChI | InChI=1S/C6H15ClN2/c1-9-5-6(7)3-2-4-8/h6,9H,2-5,8H2,1H3 |
| InChIKey | MPNJLNYCEWDIBH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.65 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|