C3H7Cl4N — CID 175404226
2,3,3-trichloropropan-1-amine;hydrochloride (PubChem CID 175404226) has the molecular formula C3H7Cl4N and a molecular weight of 198.91 g/mol. Its IUPAC name is 2,3,3-trichloropropan-1-amine;hydrochloride.
| Compound Name | 2,3,3-trichloropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 175404226 |
| Molecular Formula | C3H7Cl4N |
| Molecular Weight | 198.91 g/mol |
| Exact Mass | 196.93 |
| IUPAC Name | 2,3,3-trichloropropan-1-amine;hydrochloride |
| SMILES | Cl.NCC(Cl)C(Cl)Cl |
| InChI | InChI=1S/C3H6Cl3N.ClH/c4-2(1-7)3(5)6;/h2-3H,1,7H2;1H |
| InChIKey | JSSDIUISWPKMHH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.91 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|