C7H16Cl2N2O — CID 90238172
3-(aminomethyl)-1,1-dichloro-4-(dimethylamino)butan-2-ol (PubChem CID 90238172) has the molecular formula C7H16Cl2N2O and a molecular weight of 215.12 g/mol. Its IUPAC name is 3-(aminomethyl)-1,1-dichloro-4-(dimethylamino)butan-2-ol.
| Compound Name | 3-(aminomethyl)-1,1-dichloro-4-(dimethylamino)butan-2-ol |
|---|---|
| PubChem CID | 90238172 |
| Molecular Formula | C7H16Cl2N2O |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-(aminomethyl)-1,1-dichloro-4-(dimethylamino)butan-2-ol |
| SMILES | CN(C)CC(CN)C(O)C(Cl)Cl |
| InChI | InChI=1S/C7H16Cl2N2O/c1-11(2)4-5(3-10)6(12)7(8)9/h5-7,12H,3-4,10H2,1-2H3 |
| InChIKey | JQOHRPCWWRFUEL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|