About 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride
2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride (PubChem CID 74765572) has the molecular formula C5H13Cl2N
and a molecular weight of 158.07 g/mol. Its IUPAC name is 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride.
Molecular Properties
| Compound Name | 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride |
| PubChem CID | 74765572 |
| Molecular Formula | C5H13Cl2N |
| Molecular Weight | 158.07 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride |
| SMILES | CC(Cl)CN(C)C.[Cl-].[H+] |
| InChI | InChI=1S/C5H12ClN.ClH/c1-5(6)4-7(2)3;/h5H,4H2,1-3H3;1H |
| InChIKey | OCWGRWAYARCRTQ-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.07 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride?
The IUPAC name of 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride (CID 74765572) is 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride.
What is the SMILES notation for 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride?
The canonical SMILES for 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride is CC(Cl)CN(C)C.[Cl-].[H+].
What is the InChIKey of 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride?
The InChIKey is OCWGRWAYARCRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12ClN.ClH/c1-5(6)4-7(2)3;/h5H,4H2,1-3H3;1H.
What are the key properties of 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride?
2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride has a molecular weight of 158.07 g/mol, XLogP of -1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-dimethylpropan-1-amine;hydron;chloride is sourced from PubChem (CID 74765572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).