About 2-chloro-N,N-dimethylethanamine
2-chloro-N,N-dimethylethanamine (PubChem CID 7901) has the molecular formula C4H10ClN
and a molecular weight of 107.58 g/mol. Its IUPAC name is 2-chloro-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-chloro-N,N-dimethylethanamine |
| PubChem CID | 7901 |
| Molecular Formula | C4H10ClN |
| Molecular Weight | 107.58 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | 2-chloro-N,N-dimethylethanamine |
| SMILES | CN(C)CCCl |
| InChI | InChI=1S/C4H10ClN/c1-6(2)4-3-5/h3-4H2,1-2H3 |
| InChIKey | WQMAANNAZKNUDL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.58 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-dimethylethanamine?
The IUPAC name of 2-chloro-N,N-dimethylethanamine (CID 7901) is 2-chloro-N,N-dimethylethanamine.
What is the SMILES notation for 2-chloro-N,N-dimethylethanamine?
The canonical SMILES for 2-chloro-N,N-dimethylethanamine is CN(C)CCCl.
What is the InChIKey of 2-chloro-N,N-dimethylethanamine?
The InChIKey is WQMAANNAZKNUDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10ClN/c1-6(2)4-3-5/h3-4H2,1-2H3.
What are the key properties of 2-chloro-N,N-dimethylethanamine?
2-chloro-N,N-dimethylethanamine has a molecular weight of 107.58 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-dimethylethanamine is sourced from PubChem (CID 7901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).