C21H40Cl2N4 — CID 67639154
3,5-dichlorooctadecan-1-amine;1,3,5-triazine (PubChem CID 67639154) has the molecular formula C21H40Cl2N4 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3,5-dichlorooctadecan-1-amine;1,3,5-triazine.
| Compound Name | 3,5-dichlorooctadecan-1-amine;1,3,5-triazine |
|---|---|
| PubChem CID | 67639154 |
| Molecular Formula | C21H40Cl2N4 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 3,5-dichlorooctadecan-1-amine;1,3,5-triazine |
| SMILES | CCCCCCCCCCCCCC(Cl)CC(Cl)CCN.c1ncncn1 |
| InChI | InChI=1S/C18H37Cl2N.C3H3N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(19)16-18(20)14-15-21;1-4-2-6-3-5-1/h17-18H,2-16,21H2,1H3;1-3H |
| InChIKey | SVGAXOMPYXEOPS-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|